C11H14N2O2 — CID 63951273
6-(2-methoxyethoxy)-N-prop-2-ynylpyridin-3-amine (PubChem CID 63951273) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 6-(2-methoxyethoxy)-N-prop-2-ynylpyridin-3-amine.
| Compound Name | 6-(2-methoxyethoxy)-N-prop-2-ynylpyridin-3-amine |
|---|---|
| PubChem CID | 63951273 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 6-(2-methoxyethoxy)-N-prop-2-ynylpyridin-3-amine |
| SMILES | C#CCNc1ccc(OCCOC)nc1 |
| InChI | InChI=1S/C11H14N2O2/c1-3-6-12-10-4-5-11(13-9-10)15-8-7-14-2/h1,4-5,9,12H,6-8H2,2H3 |
| InChIKey | AFZBRMMHIYIDHT-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|