C17H11F4NO3 — CID 9046548
(E)-N-[4-(difluoromethoxy)phenyl]-4-(3,4-difluorophenyl)-4-oxobut-2-enamide (PubChem CID 9046548) has the molecular formula C17H11F4NO3 and a molecular weight of 353.27 g/mol. Its IUPAC name is (E)-N-[4-(difluoromethoxy)phenyl]-4-(3,4-difluorophenyl)-4-oxobut-2-enamide.
| Compound Name | (E)-N-[4-(difluoromethoxy)phenyl]-4-(3,4-difluorophenyl)-4-oxobut-2-enamide |
|---|---|
| PubChem CID | 9046548 |
| Molecular Formula | C17H11F4NO3 |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | (E)-N-[4-(difluoromethoxy)phenyl]-4-(3,4-difluorophenyl)-4-oxobut-2-enamide |
| SMILES | O=C(/C=C/C(=O)c1ccc(F)c(F)c1)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H11F4NO3/c18-13-6-1-10(9-14(13)19)15(23)7-8-16(24)22-11-2-4-12(5-3-11)25-17(20)21/h1-9,17H,(H,22,24)/b8-7+ |
| InChIKey | LQNSBHMOUSDYSK-BQYQJAHWSA-N |
| XLogP | 3.94 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|