C18H15F2NO4 — CID 9044800
(E)-4-(3,4-difluorophenyl)-N-(3,5-dimethoxyphenyl)-4-oxobut-2-enamide (PubChem CID 9044800) has the molecular formula C18H15F2NO4 and a molecular weight of 347.32 g/mol. Its IUPAC name is (E)-4-(3,4-difluorophenyl)-N-(3,5-dimethoxyphenyl)-4-oxobut-2-enamide.
| Compound Name | (E)-4-(3,4-difluorophenyl)-N-(3,5-dimethoxyphenyl)-4-oxobut-2-enamide |
|---|---|
| PubChem CID | 9044800 |
| Molecular Formula | C18H15F2NO4 |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | (E)-4-(3,4-difluorophenyl)-N-(3,5-dimethoxyphenyl)-4-oxobut-2-enamide |
| SMILES | COc1cc(NC(=O)/C=C/C(=O)c2ccc(F)c(F)c2)cc(OC)c1 |
| InChI | InChI=1S/C18H15F2NO4/c1-24-13-8-12(9-14(10-13)25-2)21-18(23)6-5-17(22)11-3-4-15(19)16(20)7-11/h3-10H,1-2H3,(H,21,23)/b6-5+ |
| InChIKey | XMMUPWSDTQXVNI-AATRIKPKSA-N |
| XLogP | 3.36 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|