C17H15FO3 — CID 8856238
(E)-3-(3,5-dimethoxyphenyl)-1-(4-fluorophenyl)prop-2-en-1-one (PubChem CID 8856238) has the molecular formula C17H15FO3 and a molecular weight of 286.30 g/mol. Its IUPAC name is (E)-3-(3,5-dimethoxyphenyl)-1-(4-fluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(3,5-dimethoxyphenyl)-1-(4-fluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 8856238 |
| Molecular Formula | C17H15FO3 |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | (E)-3-(3,5-dimethoxyphenyl)-1-(4-fluorophenyl)prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)c2ccc(F)cc2)cc(OC)c1 |
| InChI | InChI=1S/C17H15FO3/c1-20-15-9-12(10-16(11-15)21-2)3-8-17(19)13-4-6-14(18)7-5-13/h3-11H,1-2H3/b8-3+ |
| InChIKey | CTWDWWHURMVTSD-FPYGCLRLSA-N |
| XLogP | 3.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|