C32H26FNO4 — CID 171343697
(E)-3-[4-[(Z)-[(E)-1,3-bis(4-methoxyphenyl)prop-2-enylidene]amino]oxyphenyl]-1-(4-fluorophenyl)prop-2-en-1-one (PubChem CID 171343697) has the molecular formula C32H26FNO4 and a molecular weight of 507.56 g/mol. Its IUPAC name is (E)-3-[4-[(Z)-[(E)-1,3-bis(4-methoxyphenyl)prop-2-enylidene]amino]oxyphenyl]-1-(4-fluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-[(Z)-[(E)-1,3-bis(4-methoxyphenyl)prop-2-enylidene]amino]oxyphenyl]-1-(4-fluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 171343697 |
| Molecular Formula | C32H26FNO4 |
| Molecular Weight | 507.56 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | (E)-3-[4-[(Z)-[(E)-1,3-bis(4-methoxyphenyl)prop-2-enylidene]amino]oxyphenyl]-1-(4-fluorophenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=N/Oc2ccc(/C=C/C(=O)c3ccc(F)cc3)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H26FNO4/c1-36-28-15-3-23(4-16-28)7-21-31(25-11-19-29(37-2)20-12-25)34-38-30-17-5-24(6-18-30)8-22-32(35)26-9-13-27(33)14-10-26/h3-22H,1-2H3/b21-7+,22-8+,34-31- |
| InChIKey | XRWOGUBTQNJHSD-NAYFDBJDSA-N |
| XLogP | 7.24 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.56 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|