C17H13F3O — CID 11500240
1-[(3E)-1,1-difluoro-4-(4-fluorophenyl)buta-1,3-dien-2-yl]-4-methoxybenzene (PubChem CID 11500240) has the molecular formula C17H13F3O and a molecular weight of 290.28 g/mol. Its IUPAC name is 1-[(3E)-1,1-difluoro-4-(4-fluorophenyl)buta-1,3-dien-2-yl]-4-methoxybenzene.
| Compound Name | 1-[(3E)-1,1-difluoro-4-(4-fluorophenyl)buta-1,3-dien-2-yl]-4-methoxybenzene |
|---|---|
| PubChem CID | 11500240 |
| Molecular Formula | C17H13F3O |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 1-[(3E)-1,1-difluoro-4-(4-fluorophenyl)buta-1,3-dien-2-yl]-4-methoxybenzene |
| SMILES | COc1ccc(C(/C=C/c2ccc(F)cc2)=C(F)F)cc1 |
| InChI | InChI=1S/C17H13F3O/c1-21-15-9-5-13(6-10-15)16(17(19)20)11-4-12-2-7-14(18)8-3-12/h2-11H,1H3/b11-4+ |
| InChIKey | TTWOGPXHMBAJKZ-NYYWCZLTSA-N |
| XLogP | 5.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|