C18H14FNO — CID 1248488
2-(4-fluorophenyl)-5-(4-methoxyphenyl)penta-2,4-dienenitrile (PubChem CID 1248488) has the molecular formula C18H14FNO and a molecular weight of 279.31 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-(4-methoxyphenyl)penta-2,4-dienenitrile.
| Compound Name | 2-(4-fluorophenyl)-5-(4-methoxyphenyl)penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 1248488 |
| Molecular Formula | C18H14FNO |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 2-(4-fluorophenyl)-5-(4-methoxyphenyl)penta-2,4-dienenitrile |
| SMILES | COc1ccc(C=CC=C(C#N)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H14FNO/c1-21-18-11-5-14(6-12-18)3-2-4-16(13-20)15-7-9-17(19)10-8-15/h2-12H,1H3 |
| InChIKey | BPQNOUQCVAHSEU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|