C13H16O — CID 10965272
1-methoxy-4-[(1E)-4-methylpenta-1,3-dienyl]benzene (PubChem CID 10965272) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is 1-methoxy-4-[(1E)-4-methylpenta-1,3-dienyl]benzene.
| Compound Name | 1-methoxy-4-[(1E)-4-methylpenta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 10965272 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 1-methoxy-4-[(1E)-4-methylpenta-1,3-dienyl]benzene |
| SMILES | COc1ccc(/C=C/C=C(C)C)cc1 |
| InChI | InChI=1S/C13H16O/c1-11(2)5-4-6-12-7-9-13(14-3)10-8-12/h4-10H,1-3H3/b6-4+ |
| InChIKey | XCYLKEAGCSOGSE-GQCTYLIASA-N |
| XLogP | 3.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|