C11H11ClO — CID 101396307
1-[(1E,3E)-4-chlorobuta-1,3-dienyl]-4-methoxybenzene (PubChem CID 101396307) has the molecular formula C11H11ClO and a molecular weight of 194.66 g/mol. Its IUPAC name is 1-[(1E,3E)-4-chlorobuta-1,3-dienyl]-4-methoxybenzene.
| Compound Name | 1-[(1E,3E)-4-chlorobuta-1,3-dienyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 101396307 |
| Molecular Formula | C11H11ClO |
| Molecular Weight | 194.66 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 1-[(1E,3E)-4-chlorobuta-1,3-dienyl]-4-methoxybenzene |
| SMILES | COc1ccc(/C=C/C=C/Cl)cc1 |
| InChI | InChI=1S/C11H11ClO/c1-13-11-7-5-10(6-8-11)4-2-3-9-12/h2-9H,1H3/b4-2+,9-3+ |
| InChIKey | XGECYHHFXDIUDU-QIAUARBPSA-N |
| XLogP | 3.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.66 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|