C10H8Cl2 — CID 73211746
1-chloro-4-(4-chlorobuta-1,3-dienyl)benzene (PubChem CID 73211746) has the molecular formula C10H8Cl2 and a molecular weight of 199.08 g/mol. Its IUPAC name is 1-chloro-4-(4-chlorobuta-1,3-dienyl)benzene.
| Compound Name | 1-chloro-4-(4-chlorobuta-1,3-dienyl)benzene |
|---|---|
| PubChem CID | 73211746 |
| Molecular Formula | C10H8Cl2 |
| Molecular Weight | 199.08 g/mol |
| Exact Mass | 198.00 |
| IUPAC Name | 1-chloro-4-(4-chlorobuta-1,3-dienyl)benzene |
| SMILES | ClC=CC=Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H8Cl2/c11-8-2-1-3-9-4-6-10(12)7-5-9/h1-8H |
| InChIKey | ZOJIAXCUGSZKHU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.08 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|