C19H19Cl — CID 72540254
1-chloro-4-[4-(4-propan-2-ylphenyl)buta-1,3-dienyl]benzene (PubChem CID 72540254) has the molecular formula C19H19Cl and a molecular weight of 282.81 g/mol. Its IUPAC name is 1-chloro-4-[4-(4-propan-2-ylphenyl)buta-1,3-dienyl]benzene.
| Compound Name | 1-chloro-4-[4-(4-propan-2-ylphenyl)buta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 72540254 |
| Molecular Formula | C19H19Cl |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 1-chloro-4-[4-(4-propan-2-ylphenyl)buta-1,3-dienyl]benzene |
| SMILES | CC(C)c1ccc(C=CC=Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H19Cl/c1-15(2)18-11-7-16(8-12-18)5-3-4-6-17-9-13-19(20)14-10-17/h3-15H,1-2H3 |
| InChIKey | YMSFYOFUXLAGCW-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|