About 1-(6-methylhepta-1,3,5-trienyl)-4-propan-2-ylbenzene
1-(6-methylhepta-1,3,5-trienyl)-4-propan-2-ylbenzene (PubChem CID 123372314) has the molecular formula C17H22
and a molecular weight of 226.36 g/mol. Its IUPAC name is 1-(6-methylhepta-1,3,5-trienyl)-4-propan-2-ylbenzene.
Molecular Properties
| Compound Name | 1-(6-methylhepta-1,3,5-trienyl)-4-propan-2-ylbenzene |
| PubChem CID | 123372314 |
| Molecular Formula | C17H22 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 1-(6-methylhepta-1,3,5-trienyl)-4-propan-2-ylbenzene |
| SMILES | CC(C)=CC=CC=Cc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C17H22/c1-14(2)8-6-5-7-9-16-10-12-17(13-11-16)15(3)4/h5-13,15H,1-4H3 |
| InChIKey | KTFQBAOCVZRWFS-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-(6-methylhepta-1,3,5-trienyl)-4-propan-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-methylhepta-1,3,5-trienyl)-4-propan-2-ylbenzene?
The IUPAC name of 1-(6-methylhepta-1,3,5-trienyl)-4-propan-2-ylbenzene (CID 123372314) is 1-(6-methylhepta-1,3,5-trienyl)-4-propan-2-ylbenzene.
What is the SMILES notation for 1-(6-methylhepta-1,3,5-trienyl)-4-propan-2-ylbenzene?
The canonical SMILES for 1-(6-methylhepta-1,3,5-trienyl)-4-propan-2-ylbenzene is CC(C)=CC=CC=Cc1ccc(C(C)C)cc1.
What is the InChIKey of 1-(6-methylhepta-1,3,5-trienyl)-4-propan-2-ylbenzene?
The InChIKey is KTFQBAOCVZRWFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22/c1-14(2)8-6-5-7-9-16-10-12-17(13-11-16)15(3)4/h5-13,15H,1-4H3.
What are the key properties of 1-(6-methylhepta-1,3,5-trienyl)-4-propan-2-ylbenzene?
1-(6-methylhepta-1,3,5-trienyl)-4-propan-2-ylbenzene has a molecular weight of 226.36 g/mol, XLogP of 5.35, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-methylhepta-1,3,5-trienyl)-4-propan-2-ylbenzene is sourced from PubChem (CID 123372314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).