C75H69N3 — CID 58596504
4-[(E)-2-[3,5-bis[(E)-2-[4-(N-(4-propan-2-ylphenyl)anilino)phenyl]ethenyl]phenyl]ethenyl]-N-phenyl-N-(4-propan-2-ylphenyl)aniline (PubChem CID 58596504) has the molecular formula C75H69N3 and a molecular weight of 1012.40 g/mol. Its IUPAC name is 4-[(E)-2-[3,5-bis[(E)-2-[4-(N-(4-propan-2-ylphenyl)anilino)phenyl]ethenyl]phenyl]ethenyl]-N-phenyl-N-(4-propan-2-ylphenyl)aniline.
| Compound Name | 4-[(E)-2-[3,5-bis[(E)-2-[4-(N-(4-propan-2-ylphenyl)anilino)phenyl]ethenyl]phenyl]ethenyl]-N-phenyl-N-(4-propan-2-ylphenyl)aniline |
|---|---|
| PubChem CID | 58596504 |
| Molecular Formula | C75H69N3 |
| Molecular Weight | 1012.40 g/mol |
| Exact Mass | 1011.55 |
| IUPAC Name | 4-[(E)-2-[3,5-bis[(E)-2-[4-(N-(4-propan-2-ylphenyl)anilino)phenyl]ethenyl]phenyl]ethenyl]-N-phenyl-N-(4-propan-2-ylphenyl)aniline |
| SMILES | CC(C)c1ccc(N(c2ccccc2)c2ccc(/C=C/c3cc(/C=C/c4ccc(N(c5ccccc5)c5ccc(C(C)C)cc5)cc4)cc(/C=C/c4ccc(N(c5ccccc5)c5ccc(C(C)C)cc5)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C75H69N3/c1-55(2)64-34-46-73(47-35-64)76(67-16-10-7-11-17-67)70-40-28-58(29-41-70)22-25-61-52-62(26-23-59-30-42-71(43-31-59)77(68-18-12-8-13-19-68)74-48-36-65(37-49-74)56(3)4)54-63(53-61)27-24-60-32-44-72(45-33-60)78(69-20-14-9-15-21-69)75-50-38-66(39-51-75)57(5)6/h7-57H,1-6H3/b25-22+,26-23+,27-24+ |
| InChIKey | KZDKFFODFSBYRI-NQXXUPRISA-N |
| XLogP | 21.98 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1012.40 |
| LogP ≤ 5 | 21.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|