C33H35N — CID 89097686
N-(4-butan-2-ylphenyl)-4-(2-phenylethenyl)-N-(4-propan-2-ylphenyl)aniline (PubChem CID 89097686) has the molecular formula C33H35N and a molecular weight of 445.65 g/mol. Its IUPAC name is N-(4-butan-2-ylphenyl)-4-(2-phenylethenyl)-N-(4-propan-2-ylphenyl)aniline.
| Compound Name | N-(4-butan-2-ylphenyl)-4-(2-phenylethenyl)-N-(4-propan-2-ylphenyl)aniline |
|---|---|
| PubChem CID | 89097686 |
| Molecular Formula | C33H35N |
| Molecular Weight | 445.65 g/mol |
| Exact Mass | 445.28 |
| IUPAC Name | N-(4-butan-2-ylphenyl)-4-(2-phenylethenyl)-N-(4-propan-2-ylphenyl)aniline |
| SMILES | CCC(C)c1ccc(N(c2ccc(C=Cc3ccccc3)cc2)c2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C33H35N/c1-5-26(4)30-17-23-33(24-18-30)34(32-21-15-29(16-22-32)25(2)3)31-19-13-28(14-20-31)12-11-27-9-7-6-8-10-27/h6-26H,5H2,1-4H3 |
| InChIKey | YLVIYXISHKRRAM-UHFFFAOYSA-N |
| XLogP | 9.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.65 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|