C30H41N — CID 143909835
N-(4-butan-2-ylphenyl)-4-propan-2-yl-N-(4-propan-2-ylphenyl)aniline;ethane (PubChem CID 143909835) has the molecular formula C30H41N and a molecular weight of 415.67 g/mol. Its IUPAC name is N-(4-butan-2-ylphenyl)-4-propan-2-yl-N-(4-propan-2-ylphenyl)aniline;ethane.
| Compound Name | N-(4-butan-2-ylphenyl)-4-propan-2-yl-N-(4-propan-2-ylphenyl)aniline;ethane |
|---|---|
| PubChem CID | 143909835 |
| Molecular Formula | C30H41N |
| Molecular Weight | 415.67 g/mol |
| Exact Mass | 415.32 |
| IUPAC Name | N-(4-butan-2-ylphenyl)-4-propan-2-yl-N-(4-propan-2-ylphenyl)aniline;ethane |
| SMILES | CC.CCC(C)c1ccc(N(c2ccc(C(C)C)cc2)c2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C28H35N.C2H6/c1-7-22(6)25-12-18-28(19-13-25)29(26-14-8-23(9-15-26)20(2)3)27-16-10-24(11-17-27)21(4)5;1-2/h8-22H,7H2,1-6H3;1-2H3 |
| InChIKey | BNMFCQCYJJNSRY-UHFFFAOYSA-N |
| XLogP | 9.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.67 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |