C27H33N — CID 143650432
N-(4-butan-2-ylphenyl)-4-ethyl-N-(4-propylphenyl)aniline (PubChem CID 143650432) has the molecular formula C27H33N and a molecular weight of 371.57 g/mol. Its IUPAC name is N-(4-butan-2-ylphenyl)-4-ethyl-N-(4-propylphenyl)aniline.
| Compound Name | N-(4-butan-2-ylphenyl)-4-ethyl-N-(4-propylphenyl)aniline |
|---|---|
| PubChem CID | 143650432 |
| Molecular Formula | C27H33N |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | N-(4-butan-2-ylphenyl)-4-ethyl-N-(4-propylphenyl)aniline |
| SMILES | CCCc1ccc(N(c2ccc(CC)cc2)c2ccc(C(C)CC)cc2)cc1 |
| InChI | InChI=1S/C27H33N/c1-5-8-23-11-17-26(18-12-23)28(25-15-9-22(7-3)10-16-25)27-19-13-24(14-20-27)21(4)6-2/h9-21H,5-8H2,1-4H3 |
| InChIKey | VSJVZTUHFMSJBV-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |