C25H33N — CID 159095466
N-(4-butan-2-ylphenyl)-3-methyl-N-phenylaniline;methane (PubChem CID 159095466) has the molecular formula C25H33N and a molecular weight of 347.55 g/mol. Its IUPAC name is N-(4-butan-2-ylphenyl)-3-methyl-N-phenylaniline;methane.
| Compound Name | N-(4-butan-2-ylphenyl)-3-methyl-N-phenylaniline;methane |
|---|---|
| PubChem CID | 159095466 |
| Molecular Formula | C25H33N |
| Molecular Weight | 347.55 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | N-(4-butan-2-ylphenyl)-3-methyl-N-phenylaniline;methane |
| SMILES | C.C.CCC(C)c1ccc(N(c2ccccc2)c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C23H25N.2CH4/c1-4-19(3)20-13-15-22(16-14-20)24(21-10-6-5-7-11-21)23-12-8-9-18(2)17-23;;/h5-17,19H,4H2,1-3H3;2*1H4 |
| InChIKey | KCPMHGSJJBRJJN-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.55 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |