C41H38N2 — CID 121295792
3-methyl-N-[4-[4-(N-(3-methylphenyl)-4-propan-2-ylanilino)phenyl]phenyl]-N-phenylaniline (PubChem CID 121295792) has the molecular formula C41H38N2 and a molecular weight of 558.77 g/mol. Its IUPAC name is 3-methyl-N-[4-[4-(N-(3-methylphenyl)-4-propan-2-ylanilino)phenyl]phenyl]-N-phenylaniline.
| Compound Name | 3-methyl-N-[4-[4-(N-(3-methylphenyl)-4-propan-2-ylanilino)phenyl]phenyl]-N-phenylaniline |
|---|---|
| PubChem CID | 121295792 |
| Molecular Formula | C41H38N2 |
| Molecular Weight | 558.77 g/mol |
| Exact Mass | 558.30 |
| IUPAC Name | 3-methyl-N-[4-[4-(N-(3-methylphenyl)-4-propan-2-ylanilino)phenyl]phenyl]-N-phenylaniline |
| SMILES | Cc1cccc(N(c2ccccc2)c2ccc(-c3ccc(N(c4ccc(C(C)C)cc4)c4cccc(C)c4)cc3)cc2)c1 |
| InChI | InChI=1S/C41H38N2/c1-30(2)33-16-22-37(23-17-33)43(41-15-9-11-32(4)29-41)39-26-20-35(21-27-39)34-18-24-38(25-19-34)42(36-12-6-5-7-13-36)40-14-8-10-31(3)28-40/h5-30H,1-4H3 |
| InChIKey | FIRFGOJVECJWCT-UHFFFAOYSA-N |
| XLogP | 12.03 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.77 |
| LogP ≤ 5 | 12.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |