C31H23Cl2N — CID 14669996
N,N-bis[4-(4-chlorophenyl)phenyl]-3-methylaniline (PubChem CID 14669996) has the molecular formula C31H23Cl2N and a molecular weight of 480.44 g/mol. Its IUPAC name is N,N-bis[4-(4-chlorophenyl)phenyl]-3-methylaniline.
| Compound Name | N,N-bis[4-(4-chlorophenyl)phenyl]-3-methylaniline |
|---|---|
| PubChem CID | 14669996 |
| Molecular Formula | C31H23Cl2N |
| Molecular Weight | 480.44 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | N,N-bis[4-(4-chlorophenyl)phenyl]-3-methylaniline |
| SMILES | Cc1cccc(N(c2ccc(-c3ccc(Cl)cc3)cc2)c2ccc(-c3ccc(Cl)cc3)cc2)c1 |
| InChI | InChI=1S/C31H23Cl2N/c1-22-3-2-4-31(21-22)34(29-17-9-25(10-18-29)23-5-13-27(32)14-6-23)30-19-11-26(12-20-30)24-7-15-28(33)16-8-24/h2-21H,1H3 |
| InChIKey | QSYFXEDNZLKBBS-UHFFFAOYSA-N |
| XLogP | 10.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.44 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |