C12H14 — CID 3614395
4-methylpenta-1,3-dienylbenzene (PubChem CID 3614395) has the molecular formula C12H14 and a molecular weight of 158.24 g/mol. Its IUPAC name is 4-methylpenta-1,3-dienylbenzene.
| Compound Name | 4-methylpenta-1,3-dienylbenzene |
|---|---|
| PubChem CID | 3614395 |
| Molecular Formula | C12H14 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 4-methylpenta-1,3-dienylbenzene |
| SMILES | CC(C)=CC=Cc1ccccc1 |
| InChI | InChI=1S/C12H14/c1-11(2)7-6-10-12-8-4-3-5-9-12/h3-10H,1-2H3 |
| InChIKey | ZVNDSQGHZLPKQV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|