About 4-(5-phenylpenta-2,4-dien-2-yl)phenol
4-(5-phenylpenta-2,4-dien-2-yl)phenol (PubChem CID 87425286) has the molecular formula C17H16O
and a molecular weight of 236.31 g/mol. Its IUPAC name is 4-(5-phenylpenta-2,4-dien-2-yl)phenol.
Molecular Properties
| Compound Name | 4-(5-phenylpenta-2,4-dien-2-yl)phenol |
| PubChem CID | 87425286 |
| Molecular Formula | C17H16O |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 4-(5-phenylpenta-2,4-dien-2-yl)phenol |
| SMILES | CC(=CC=Cc1ccccc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C17H16O/c1-14(16-10-12-17(18)13-11-16)6-5-9-15-7-3-2-4-8-15/h2-13,18H,1H3 |
| InChIKey | DPWZICZYXKXJPW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-phenylpenta-2,4-dien-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-phenylpenta-2,4-dien-2-yl)phenol?
The IUPAC name of 4-(5-phenylpenta-2,4-dien-2-yl)phenol (CID 87425286) is 4-(5-phenylpenta-2,4-dien-2-yl)phenol.
What is the SMILES notation for 4-(5-phenylpenta-2,4-dien-2-yl)phenol?
The canonical SMILES for 4-(5-phenylpenta-2,4-dien-2-yl)phenol is CC(=CC=Cc1ccccc1)c1ccc(O)cc1.
What is the InChIKey of 4-(5-phenylpenta-2,4-dien-2-yl)phenol?
The InChIKey is DPWZICZYXKXJPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O/c1-14(16-10-12-17(18)13-11-16)6-5-9-15-7-3-2-4-8-15/h2-13,18H,1H3.
What are the key properties of 4-(5-phenylpenta-2,4-dien-2-yl)phenol?
4-(5-phenylpenta-2,4-dien-2-yl)phenol has a molecular weight of 236.31 g/mol, XLogP of 4.51, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-phenylpenta-2,4-dien-2-yl)phenol is sourced from PubChem (CID 87425286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).