C18H18 — CID 54269613
1-methyl-4-(4-phenylpenta-1,3-dienyl)benzene (PubChem CID 54269613) has the molecular formula C18H18 and a molecular weight of 234.34 g/mol. Its IUPAC name is 1-methyl-4-(4-phenylpenta-1,3-dienyl)benzene.
| Compound Name | 1-methyl-4-(4-phenylpenta-1,3-dienyl)benzene |
|---|---|
| PubChem CID | 54269613 |
| Molecular Formula | C18H18 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1-methyl-4-(4-phenylpenta-1,3-dienyl)benzene |
| SMILES | CC(=CC=Cc1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H18/c1-15-11-13-17(14-12-15)8-6-7-16(2)18-9-4-3-5-10-18/h3-14H,1-2H3 |
| InChIKey | RJFNBULRRSYCRY-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|