About 5-phenylhexa-2,4-dienal
5-phenylhexa-2,4-dienal (PubChem CID 71444454) has the molecular formula C12H12O
and a molecular weight of 172.23 g/mol. Its IUPAC name is 5-phenylhexa-2,4-dienal.
Molecular Properties
| Compound Name | 5-phenylhexa-2,4-dienal |
| PubChem CID | 71444454 |
| Molecular Formula | C12H12O |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | 5-phenylhexa-2,4-dienal |
| SMILES | CC(=CC=CC=O)c1ccccc1 |
| InChI | InChI=1S/C12H12O/c1-11(7-5-6-10-13)12-8-3-2-4-9-12/h2-10H,1H3 |
| InChIKey | PGCCYRKGHJACDN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-phenylhexa-2,4-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenylhexa-2,4-dienal?
The IUPAC name of 5-phenylhexa-2,4-dienal (CID 71444454) is 5-phenylhexa-2,4-dienal.
What is the SMILES notation for 5-phenylhexa-2,4-dienal?
The canonical SMILES for 5-phenylhexa-2,4-dienal is CC(=CC=CC=O)c1ccccc1.
What is the InChIKey of 5-phenylhexa-2,4-dienal?
The InChIKey is PGCCYRKGHJACDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O/c1-11(7-5-6-10-13)12-8-3-2-4-9-12/h2-10H,1H3.
What are the key properties of 5-phenylhexa-2,4-dienal?
5-phenylhexa-2,4-dienal has a molecular weight of 172.23 g/mol, XLogP of 2.85, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenylhexa-2,4-dienal is sourced from PubChem (CID 71444454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).