C21H22O — CID 139864359
2,8-diphenylnona-2,7-dien-5-one (PubChem CID 139864359) has the molecular formula C21H22O and a molecular weight of 290.41 g/mol. Its IUPAC name is 2,8-diphenylnona-2,7-dien-5-one.
| Compound Name | 2,8-diphenylnona-2,7-dien-5-one |
|---|---|
| PubChem CID | 139864359 |
| Molecular Formula | C21H22O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 2,8-diphenylnona-2,7-dien-5-one |
| SMILES | CC(=CCC(=O)CC=C(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H22O/c1-17(19-9-5-3-6-10-19)13-15-21(22)16-14-18(2)20-11-7-4-8-12-20/h3-14H,15-16H2,1-2H3 |
| InChIKey | NBXVMGHVBCZCMM-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |