About iodomethane;(Z)-3-phenylbut-2-en-1-ol;zinc
iodomethane;(Z)-3-phenylbut-2-en-1-ol;zinc (PubChem CID 135060356) has the molecular formula C11H14IOZn-
and a molecular weight of 354.53 g/mol. Its IUPAC name is iodomethane;(Z)-3-phenylbut-2-en-1-ol;zinc.
Molecular Properties
| Compound Name | iodomethane;(Z)-3-phenylbut-2-en-1-ol;zinc |
| PubChem CID | 135060356 |
| Molecular Formula | C11H14IOZn- |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 352.94 |
| IUPAC Name | iodomethane;(Z)-3-phenylbut-2-en-1-ol;zinc |
| SMILES | C/C(=C/CO)c1ccccc1.[CH2-]I.[Zn] |
| InChI | InChI=1S/C10H12O.CH2I.Zn/c1-9(7-8-11)10-5-3-2-4-6-10;1-2;/h2-7,11H,8H2,1H3;1H2;/q;-1;/b9-7-;; |
| InChIKey | NKVYEDBQPNYBBR-COUYFGMESA-N |
| XLogP | 3.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze iodomethane;(Z)-3-phenylbut-2-en-1-ol;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodomethane;(Z)-3-phenylbut-2-en-1-ol;zinc?
The IUPAC name of iodomethane;(Z)-3-phenylbut-2-en-1-ol;zinc (CID 135060356) is iodomethane;(Z)-3-phenylbut-2-en-1-ol;zinc.
What is the SMILES notation for iodomethane;(Z)-3-phenylbut-2-en-1-ol;zinc?
The canonical SMILES for iodomethane;(Z)-3-phenylbut-2-en-1-ol;zinc is C/C(=C/CO)c1ccccc1.[CH2-]I.[Zn].
What is the InChIKey of iodomethane;(Z)-3-phenylbut-2-en-1-ol;zinc?
The InChIKey is NKVYEDBQPNYBBR-COUYFGMESA-N. The full InChI is InChI=1S/C10H12O.CH2I.Zn/c1-9(7-8-11)10-5-3-2-4-6-10;1-2;/h2-7,11H,8H2,1H3;1H2;/q;-1;/b9-7-;;.
What are the key properties of iodomethane;(Z)-3-phenylbut-2-en-1-ol;zinc?
iodomethane;(Z)-3-phenylbut-2-en-1-ol;zinc has a molecular weight of 354.53 g/mol, XLogP of 3.29, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for iodomethane;(Z)-3-phenylbut-2-en-1-ol;zinc is sourced from PubChem (CID 135060356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).