About [(E)-but-2-en-2-yl]benzene;ethane;propane
[(E)-but-2-en-2-yl]benzene;ethane;propane (PubChem CID 144534728) has the molecular formula C17H32
and a molecular weight of 236.44 g/mol. Its IUPAC name is [(E)-but-2-en-2-yl]benzene;ethane;propane.
Molecular Properties
| Compound Name | [(E)-but-2-en-2-yl]benzene;ethane;propane |
| PubChem CID | 144534728 |
| Molecular Formula | C17H32 |
| Molecular Weight | 236.44 g/mol |
| Exact Mass | 236.25 |
| IUPAC Name | [(E)-but-2-en-2-yl]benzene;ethane;propane |
| SMILES | C/C=C(\C)c1ccccc1.CC.CC.CCC |
| InChI | InChI=1S/C10H12.C3H8.2C2H6/c1-3-9(2)10-7-5-4-6-8-10;1-3-2;2*1-2/h3-8H,1-2H3;3H2,1-2H3;2*1-2H3/b9-3+;;; |
| InChIKey | HBJQSYVORBVJPO-JVHOGRKKSA-N |
| XLogP | 6.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 236.44 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze [(E)-but-2-en-2-yl]benzene;ethane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-but-2-en-2-yl]benzene;ethane;propane?
The IUPAC name of [(E)-but-2-en-2-yl]benzene;ethane;propane (CID 144534728) is [(E)-but-2-en-2-yl]benzene;ethane;propane.
What is the SMILES notation for [(E)-but-2-en-2-yl]benzene;ethane;propane?
The canonical SMILES for [(E)-but-2-en-2-yl]benzene;ethane;propane is C/C=C(\C)c1ccccc1.CC.CC.CCC.
What is the InChIKey of [(E)-but-2-en-2-yl]benzene;ethane;propane?
The InChIKey is HBJQSYVORBVJPO-JVHOGRKKSA-N. The full InChI is InChI=1S/C10H12.C3H8.2C2H6/c1-3-9(2)10-7-5-4-6-8-10;1-3-2;2*1-2/h3-8H,1-2H3;3H2,1-2H3;2*1-2H3/b9-3+;;;.
What are the key properties of [(E)-but-2-en-2-yl]benzene;ethane;propane?
[(E)-but-2-en-2-yl]benzene;ethane;propane has a molecular weight of 236.44 g/mol, XLogP of 6.58, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-but-2-en-2-yl]benzene;ethane;propane is sourced from PubChem (CID 144534728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).