About [(E)-but-2-en-2-yl]benzene;heptane;2-methylprop-1-ene
[(E)-but-2-en-2-yl]benzene;heptane;2-methylprop-1-ene (PubChem CID 144959576) has the molecular formula C21H36
and a molecular weight of 288.52 g/mol. Its IUPAC name is [(E)-but-2-en-2-yl]benzene;heptane;2-methylprop-1-ene.
Molecular Properties
| Compound Name | [(E)-but-2-en-2-yl]benzene;heptane;2-methylprop-1-ene |
| PubChem CID | 144959576 |
| Molecular Formula | C21H36 |
| Molecular Weight | 288.52 g/mol |
| Exact Mass | 288.28 |
| IUPAC Name | [(E)-but-2-en-2-yl]benzene;heptane;2-methylprop-1-ene |
| SMILES | C/C=C(\C)c1ccccc1.C=C(C)C.CCCCCCC |
| InChI | InChI=1S/C10H12.C7H16.C4H8/c1-3-9(2)10-7-5-4-6-8-10;1-3-5-7-6-4-2;1-4(2)3/h3-8H,1-2H3;3-7H2,1-2H3;1H2,2-3H3/b9-3+;; |
| InChIKey | GGWDNUNOSVKGCC-GYKBVTDZSA-N |
| XLogP | 7.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.52 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-but-2-en-2-yl]benzene;heptane;2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-but-2-en-2-yl]benzene;heptane;2-methylprop-1-ene?
The IUPAC name of [(E)-but-2-en-2-yl]benzene;heptane;2-methylprop-1-ene (CID 144959576) is [(E)-but-2-en-2-yl]benzene;heptane;2-methylprop-1-ene.
What is the SMILES notation for [(E)-but-2-en-2-yl]benzene;heptane;2-methylprop-1-ene?
The canonical SMILES for [(E)-but-2-en-2-yl]benzene;heptane;2-methylprop-1-ene is C/C=C(\C)c1ccccc1.C=C(C)C.CCCCCCC.
What is the InChIKey of [(E)-but-2-en-2-yl]benzene;heptane;2-methylprop-1-ene?
The InChIKey is GGWDNUNOSVKGCC-GYKBVTDZSA-N. The full InChI is InChI=1S/C10H12.C7H16.C4H8/c1-3-9(2)10-7-5-4-6-8-10;1-3-5-7-6-4-2;1-4(2)3/h3-8H,1-2H3;3-7H2,1-2H3;1H2,2-3H3/b9-3+;;.
What are the key properties of [(E)-but-2-en-2-yl]benzene;heptane;2-methylprop-1-ene?
[(E)-but-2-en-2-yl]benzene;heptane;2-methylprop-1-ene has a molecular weight of 288.52 g/mol, XLogP of 7.67, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-but-2-en-2-yl]benzene;heptane;2-methylprop-1-ene is sourced from PubChem (CID 144959576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).