About hex-1-en-2-ylbenzene;propan-2-one
hex-1-en-2-ylbenzene;propan-2-one (PubChem CID 142095367) has the molecular formula C15H22O
and a molecular weight of 218.34 g/mol. Its IUPAC name is hex-1-en-2-ylbenzene;propan-2-one.
Molecular Properties
| Compound Name | hex-1-en-2-ylbenzene;propan-2-one |
| PubChem CID | 142095367 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | hex-1-en-2-ylbenzene;propan-2-one |
| SMILES | C=C(CCCC)c1ccccc1.CC(C)=O |
| InChI | InChI=1S/C12H16.C3H6O/c1-3-4-8-11(2)12-9-6-5-7-10-12;1-3(2)4/h5-7,9-10H,2-4,8H2,1H3;1-2H3 |
| InChIKey | CPFGXAOXHYRRTR-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze hex-1-en-2-ylbenzene;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hex-1-en-2-ylbenzene;propan-2-one?
The IUPAC name of hex-1-en-2-ylbenzene;propan-2-one (CID 142095367) is hex-1-en-2-ylbenzene;propan-2-one.
What is the SMILES notation for hex-1-en-2-ylbenzene;propan-2-one?
The canonical SMILES for hex-1-en-2-ylbenzene;propan-2-one is C=C(CCCC)c1ccccc1.CC(C)=O.
What is the InChIKey of hex-1-en-2-ylbenzene;propan-2-one?
The InChIKey is CPFGXAOXHYRRTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16.C3H6O/c1-3-4-8-11(2)12-9-6-5-7-10-12;1-3(2)4/h5-7,9-10H,2-4,8H2,1H3;1-2H3.
What are the key properties of hex-1-en-2-ylbenzene;propan-2-one?
hex-1-en-2-ylbenzene;propan-2-one has a molecular weight of 218.34 g/mol, XLogP of 4.49, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hex-1-en-2-ylbenzene;propan-2-one is sourced from PubChem (CID 142095367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).