C24H26N2 — CID 134365137
4-N-(4-hex-1-en-2-ylphenyl)-4-N-phenylbenzene-1,4-diamine (PubChem CID 134365137) has the molecular formula C24H26N2 and a molecular weight of 342.49 g/mol. Its IUPAC name is 4-N-(4-hex-1-en-2-ylphenyl)-4-N-phenylbenzene-1,4-diamine.
| Compound Name | 4-N-(4-hex-1-en-2-ylphenyl)-4-N-phenylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 134365137 |
| Molecular Formula | C24H26N2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 4-N-(4-hex-1-en-2-ylphenyl)-4-N-phenylbenzene-1,4-diamine |
| SMILES | C=C(CCCC)c1ccc(N(c2ccccc2)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C24H26N2/c1-3-4-8-19(2)20-11-15-23(16-12-20)26(22-9-6-5-7-10-22)24-17-13-21(25)14-18-24/h5-7,9-18H,2-4,8,25H2,1H3 |
| InChIKey | NITWNDDZZMFMTE-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|