C48H38N4 — CID 22944349
4-[4-(N-[4-[4-(N-[4-(4-aminophenyl)phenyl]anilino)phenyl]phenyl]anilino)phenyl]aniline (PubChem CID 22944349) has the molecular formula C48H38N4 and a molecular weight of 670.86 g/mol. Its IUPAC name is 4-[4-(N-[4-[4-(N-[4-(4-aminophenyl)phenyl]anilino)phenyl]phenyl]anilino)phenyl]aniline.
| Compound Name | 4-[4-(N-[4-[4-(N-[4-(4-aminophenyl)phenyl]anilino)phenyl]phenyl]anilino)phenyl]aniline |
|---|---|
| PubChem CID | 22944349 |
| Molecular Formula | C48H38N4 |
| Molecular Weight | 670.86 g/mol |
| Exact Mass | 670.31 |
| IUPAC Name | 4-[4-(N-[4-[4-(N-[4-(4-aminophenyl)phenyl]anilino)phenyl]phenyl]anilino)phenyl]aniline |
| SMILES | Nc1ccc(-c2ccc(N(c3ccccc3)c3ccc(-c4ccc(N(c5ccccc5)c5ccc(-c6ccc(N)cc6)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C48H38N4/c49-41-23-11-35(12-24-41)37-15-27-45(28-16-37)51(43-7-3-1-4-8-43)47-31-19-39(20-32-47)40-21-33-48(34-22-40)52(44-9-5-2-6-10-44)46-29-17-38(18-30-46)36-13-25-42(50)26-14-36/h1-34H,49-50H2 |
| InChIKey | BHIHLWXLBYGHMS-UHFFFAOYSA-N |
| XLogP | 12.79 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.86 |
| LogP ≤ 5 | 12.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|