C30H27N3 — CID 67789837
4-(4-aminophenyl)aniline;N,N-diphenylaniline (PubChem CID 67789837) has the molecular formula C30H27N3 and a molecular weight of 429.57 g/mol. Its IUPAC name is 4-(4-aminophenyl)aniline;N,N-diphenylaniline.
| Compound Name | 4-(4-aminophenyl)aniline;N,N-diphenylaniline |
|---|---|
| PubChem CID | 67789837 |
| Molecular Formula | C30H27N3 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 4-(4-aminophenyl)aniline;N,N-diphenylaniline |
| SMILES | Nc1ccc(-c2ccc(N)cc2)cc1.c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15N.C12H12N2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h1-15H;1-8H,13-14H2 |
| InChIKey | CBUKYZWWMSRLNK-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|