C24H30 — CID 173447370
buta-1,3-diene;hex-1-en-2-ylbenzene;styrene (PubChem CID 173447370) has the molecular formula C24H30 and a molecular weight of 318.50 g/mol. Its IUPAC name is buta-1,3-diene;hex-1-en-2-ylbenzene;styrene.
| Compound Name | buta-1,3-diene;hex-1-en-2-ylbenzene;styrene |
|---|---|
| PubChem CID | 173447370 |
| Molecular Formula | C24H30 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | buta-1,3-diene;hex-1-en-2-ylbenzene;styrene |
| SMILES | C=C(CCCC)c1ccccc1.C=CC=C.C=Cc1ccccc1 |
| InChI | InChI=1S/C12H16.C8H8.C4H6/c1-3-4-8-11(2)12-9-6-5-7-10-12;1-2-8-6-4-3-5-7-8;1-3-4-2/h5-7,9-10H,2-4,8H2,1H3;2-7H,1H2;3-4H,1-2H2 |
| InChIKey | IIRYUXYJFSZNJN-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|