C21H28O6 — CID 89370738
2-methylidenehexanoic acid;2-methylidenepentanedioic acid;styrene (PubChem CID 89370738) has the molecular formula C21H28O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is 2-methylidenehexanoic acid;2-methylidenepentanedioic acid;styrene.
| Compound Name | 2-methylidenehexanoic acid;2-methylidenepentanedioic acid;styrene |
|---|---|
| PubChem CID | 89370738 |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 2-methylidenehexanoic acid;2-methylidenepentanedioic acid;styrene |
| SMILES | C=C(CCC(=O)O)C(=O)O.C=C(CCCC)C(=O)O.C=Cc1ccccc1 |
| InChI | InChI=1S/C8H8.C7H12O2.C6H8O4/c1-2-8-6-4-3-5-7-8;1-3-4-5-6(2)7(8)9;1-4(6(9)10)2-3-5(7)8/h2-7H,1H2;2-5H2,1H3,(H,8,9);1-3H2,(H,7,8)(H,9,10) |
| InChIKey | WGERKIDUNXLORC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|