C32H52O4 — CID 70268950
2-methylidenehenicosanoic acid;2-methyl-3-phenylprop-2-enoic acid (PubChem CID 70268950) has the molecular formula C32H52O4 and a molecular weight of 500.76 g/mol. Its IUPAC name is 2-methylidenehenicosanoic acid;2-methyl-3-phenylprop-2-enoic acid.
| Compound Name | 2-methylidenehenicosanoic acid;2-methyl-3-phenylprop-2-enoic acid |
|---|---|
| PubChem CID | 70268950 |
| Molecular Formula | C32H52O4 |
| Molecular Weight | 500.76 g/mol |
| Exact Mass | 500.39 |
| IUPAC Name | 2-methylidenehenicosanoic acid;2-methyl-3-phenylprop-2-enoic acid |
| SMILES | C=C(CCCCCCCCCCCCCCCCCCC)C(=O)O.CC(=Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C22H42O2.C10H10O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(2)22(23)24;1-8(10(11)12)7-9-5-3-2-4-6-9/h2-20H2,1H3,(H,23,24);2-7H,1H3,(H,11,12) |
| InChIKey | IHLOXTIJNRYYEV-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.76 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|