C21H30O5 — CID 67928086
5-hydroxy-2-methylpent-2-enoic acid;2-methylidenehexanoic acid;styrene (PubChem CID 67928086) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is 5-hydroxy-2-methylpent-2-enoic acid;2-methylidenehexanoic acid;styrene.
| Compound Name | 5-hydroxy-2-methylpent-2-enoic acid;2-methylidenehexanoic acid;styrene |
|---|---|
| PubChem CID | 67928086 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 5-hydroxy-2-methylpent-2-enoic acid;2-methylidenehexanoic acid;styrene |
| SMILES | C=C(CCCC)C(=O)O.C=Cc1ccccc1.CC(=CCCO)C(=O)O |
| InChI | InChI=1S/C8H8.C7H12O2.C6H10O3/c1-2-8-6-4-3-5-7-8;1-3-4-5-6(2)7(8)9;1-5(6(8)9)3-2-4-7/h2-7H,1H2;2-5H2,1H3,(H,8,9);3,7H,2,4H2,1H3,(H,8,9) |
| InChIKey | VNDFLNKNUNCPHX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|