C17H21NO3 — CID 67678701
5-hydroxy-2-methylpent-2-enoic acid;prop-2-enenitrile;styrene (PubChem CID 67678701) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 5-hydroxy-2-methylpent-2-enoic acid;prop-2-enenitrile;styrene.
| Compound Name | 5-hydroxy-2-methylpent-2-enoic acid;prop-2-enenitrile;styrene |
|---|---|
| PubChem CID | 67678701 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 5-hydroxy-2-methylpent-2-enoic acid;prop-2-enenitrile;styrene |
| SMILES | C=CC#N.C=Cc1ccccc1.CC(=CCCO)C(=O)O |
| InChI | InChI=1S/C8H8.C6H10O3.C3H3N/c1-2-8-6-4-3-5-7-8;1-5(6(8)9)3-2-4-7;1-2-3-4/h2-7H,1H2;3,7H,2,4H2,1H3,(H,8,9);2H,1H2 |
| InChIKey | YESJSCRFTPRVTE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|