About carbonic acid;prop-2-enenitrile;styrene
carbonic acid;prop-2-enenitrile;styrene (PubChem CID 69021114) has the molecular formula C12H13NO3
and a molecular weight of 219.24 g/mol. Its IUPAC name is carbonic acid;prop-2-enenitrile;styrene.
Molecular Properties
| Compound Name | carbonic acid;prop-2-enenitrile;styrene |
| PubChem CID | 69021114 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | carbonic acid;prop-2-enenitrile;styrene |
| SMILES | C=CC#N.C=Cc1ccccc1.O=C(O)O |
| InChI | InChI=1S/C8H8.C3H3N.CH2O3/c1-2-8-6-4-3-5-7-8;1-2-3-4;2-1(3)4/h2-7H,1H2;2H,1H2;(H2,2,3,4) |
| InChIKey | SFRHHBXDQDTWDD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze carbonic acid;prop-2-enenitrile;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;prop-2-enenitrile;styrene?
The IUPAC name of carbonic acid;prop-2-enenitrile;styrene (CID 69021114) is carbonic acid;prop-2-enenitrile;styrene.
What is the SMILES notation for carbonic acid;prop-2-enenitrile;styrene?
The canonical SMILES for carbonic acid;prop-2-enenitrile;styrene is C=CC#N.C=Cc1ccccc1.O=C(O)O.
What is the InChIKey of carbonic acid;prop-2-enenitrile;styrene?
The InChIKey is SFRHHBXDQDTWDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8.C3H3N.CH2O3/c1-2-8-6-4-3-5-7-8;1-2-3-4;2-1(3)4/h2-7H,1H2;2H,1H2;(H2,2,3,4).
What are the key properties of carbonic acid;prop-2-enenitrile;styrene?
carbonic acid;prop-2-enenitrile;styrene has a molecular weight of 219.24 g/mol, XLogP of 3.25, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;prop-2-enenitrile;styrene is sourced from PubChem (CID 69021114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).