C18H24O2 — CID 87554778
buta-1,3-diene;(E)-2-methylpent-2-enoic acid;styrene (PubChem CID 87554778) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is buta-1,3-diene;(E)-2-methylpent-2-enoic acid;styrene.
| Compound Name | buta-1,3-diene;(E)-2-methylpent-2-enoic acid;styrene |
|---|---|
| PubChem CID | 87554778 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | buta-1,3-diene;(E)-2-methylpent-2-enoic acid;styrene |
| SMILES | C=CC=C.C=Cc1ccccc1.CC/C=C(\C)C(=O)O |
| InChI | InChI=1S/C8H8.C6H10O2.C4H6/c1-2-8-6-4-3-5-7-8;1-3-4-5(2)6(7)8;1-3-4-2/h2-7H,1H2;4H,3H2,1-2H3,(H,7,8);3-4H,1-2H2/b;5-4+; |
| InChIKey | BWKVKKKESOBIIH-YHVJRZKVSA-N |
| XLogP | 5.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|