About 2-methylpent-2-eneperoxoic acid;styrene
2-methylpent-2-eneperoxoic acid;styrene (PubChem CID 174709413) has the molecular formula C14H18O3
and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-methylpent-2-eneperoxoic acid;styrene.
Molecular Properties
| Compound Name | 2-methylpent-2-eneperoxoic acid;styrene |
| PubChem CID | 174709413 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 2-methylpent-2-eneperoxoic acid;styrene |
| SMILES | C=Cc1ccccc1.CCC=C(C)C(=O)OO |
| InChI | InChI=1S/C8H8.C6H10O3/c1-2-8-6-4-3-5-7-8;1-3-4-5(2)6(7)9-8/h2-7H,1H2;4,8H,3H2,1-2H3 |
| InChIKey | HRJUGTYUKBRMJF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpent-2-eneperoxoic acid;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpent-2-eneperoxoic acid;styrene?
The IUPAC name of 2-methylpent-2-eneperoxoic acid;styrene (CID 174709413) is 2-methylpent-2-eneperoxoic acid;styrene.
What is the SMILES notation for 2-methylpent-2-eneperoxoic acid;styrene?
The canonical SMILES for 2-methylpent-2-eneperoxoic acid;styrene is C=Cc1ccccc1.CCC=C(C)C(=O)OO.
What is the InChIKey of 2-methylpent-2-eneperoxoic acid;styrene?
The InChIKey is HRJUGTYUKBRMJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8.C6H10O3/c1-2-8-6-4-3-5-7-8;1-3-4-5(2)6(7)9-8/h2-7H,1H2;4,8H,3H2,1-2H3.
What are the key properties of 2-methylpent-2-eneperoxoic acid;styrene?
2-methylpent-2-eneperoxoic acid;styrene has a molecular weight of 234.30 g/mol, XLogP of 3.69, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpent-2-eneperoxoic acid;styrene is sourced from PubChem (CID 174709413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).