About (triphenyl-λ4-sulfanyl) 2-methylpent-2-enoate
(triphenyl-λ4-sulfanyl) 2-methylpent-2-enoate (PubChem CID 141478224) has the molecular formula C24H24O2S
and a molecular weight of 376.52 g/mol. Its IUPAC name is (triphenyl-λ4-sulfanyl) 2-methylpent-2-enoate.
Molecular Properties
| Compound Name | (triphenyl-λ4-sulfanyl) 2-methylpent-2-enoate |
| PubChem CID | 141478224 |
| Molecular Formula | C24H24O2S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | (triphenyl-λ4-sulfanyl) 2-methylpent-2-enoate |
| SMILES | CCC=C(C)C(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H24O2S/c1-3-13-20(2)24(25)26-27(21-14-7-4-8-15-21,22-16-9-5-10-17-22)23-18-11-6-12-19-23/h4-19H,3H2,1-2H3 |
| InChIKey | CLDZACILEJWJQH-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (triphenyl-λ4-sulfanyl) 2-methylpent-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (triphenyl-λ4-sulfanyl) 2-methylpent-2-enoate?
The IUPAC name of (triphenyl-λ4-sulfanyl) 2-methylpent-2-enoate (CID 141478224) is (triphenyl-λ4-sulfanyl) 2-methylpent-2-enoate.
What is the SMILES notation for (triphenyl-λ4-sulfanyl) 2-methylpent-2-enoate?
The canonical SMILES for (triphenyl-λ4-sulfanyl) 2-methylpent-2-enoate is CCC=C(C)C(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of (triphenyl-λ4-sulfanyl) 2-methylpent-2-enoate?
The InChIKey is CLDZACILEJWJQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24O2S/c1-3-13-20(2)24(25)26-27(21-14-7-4-8-15-21,22-16-9-5-10-17-22)23-18-11-6-12-19-23/h4-19H,3H2,1-2H3.
What are the key properties of (triphenyl-λ4-sulfanyl) 2-methylpent-2-enoate?
(triphenyl-λ4-sulfanyl) 2-methylpent-2-enoate has a molecular weight of 376.52 g/mol, XLogP of 6.78, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (triphenyl-λ4-sulfanyl) 2-methylpent-2-enoate is sourced from PubChem (CID 141478224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).