About [acetyloxy(ethyl)silyl] acetate;styrene
[acetyloxy(ethyl)silyl] acetate;styrene (PubChem CID 174652424) has the molecular formula C14H20O4Si
and a molecular weight of 280.40 g/mol. Its IUPAC name is [acetyloxy(ethyl)silyl] acetate;styrene.
Molecular Properties
| Compound Name | [acetyloxy(ethyl)silyl] acetate;styrene |
| PubChem CID | 174652424 |
| Molecular Formula | C14H20O4Si |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | [acetyloxy(ethyl)silyl] acetate;styrene |
| SMILES | C=Cc1ccccc1.CC[SiH](OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C8H8.C6H12O4Si/c1-2-8-6-4-3-5-7-8;1-4-11(9-5(2)7)10-6(3)8/h2-7H,1H2;11H,4H2,1-3H3 |
| InChIKey | XWLGVLZKQDAXAI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [acetyloxy(ethyl)silyl] acetate;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [acetyloxy(ethyl)silyl] acetate;styrene?
The IUPAC name of [acetyloxy(ethyl)silyl] acetate;styrene (CID 174652424) is [acetyloxy(ethyl)silyl] acetate;styrene.
What is the SMILES notation for [acetyloxy(ethyl)silyl] acetate;styrene?
The canonical SMILES for [acetyloxy(ethyl)silyl] acetate;styrene is C=Cc1ccccc1.CC[SiH](OC(C)=O)OC(C)=O.
What is the InChIKey of [acetyloxy(ethyl)silyl] acetate;styrene?
The InChIKey is XWLGVLZKQDAXAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8.C6H12O4Si/c1-2-8-6-4-3-5-7-8;1-4-11(9-5(2)7)10-6(3)8/h2-7H,1H2;11H,4H2,1-3H3.
What are the key properties of [acetyloxy(ethyl)silyl] acetate;styrene?
[acetyloxy(ethyl)silyl] acetate;styrene has a molecular weight of 280.40 g/mol, XLogP of 2.68, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [acetyloxy(ethyl)silyl] acetate;styrene is sourced from PubChem (CID 174652424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).