About carbonic acid;styrene;triethyl(methyl)azanium
carbonic acid;styrene;triethyl(methyl)azanium (PubChem CID 174590917) has the molecular formula C16H28NO3+
and a molecular weight of 282.40 g/mol. Its IUPAC name is carbonic acid;styrene;triethyl(methyl)azanium.
Molecular Properties
| Compound Name | carbonic acid;styrene;triethyl(methyl)azanium |
| PubChem CID | 174590917 |
| Molecular Formula | C16H28NO3+ |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | carbonic acid;styrene;triethyl(methyl)azanium |
| SMILES | C=Cc1ccccc1.CC[N+](C)(CC)CC.O=C(O)O |
| InChI | InChI=1S/C8H8.C7H18N.CH2O3/c1-2-8-6-4-3-5-7-8;1-5-8(4,6-2)7-3;2-1(3)4/h2-7H,1H2;5-7H2,1-4H3;(H2,2,3,4)/q;+1; |
| InChIKey | DSULAOQOLCLMQO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze carbonic acid;styrene;triethyl(methyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;styrene;triethyl(methyl)azanium?
The IUPAC name of carbonic acid;styrene;triethyl(methyl)azanium (CID 174590917) is carbonic acid;styrene;triethyl(methyl)azanium.
What is the SMILES notation for carbonic acid;styrene;triethyl(methyl)azanium?
The canonical SMILES for carbonic acid;styrene;triethyl(methyl)azanium is C=Cc1ccccc1.CC[N+](C)(CC)CC.O=C(O)O.
What is the InChIKey of carbonic acid;styrene;triethyl(methyl)azanium?
The InChIKey is DSULAOQOLCLMQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8.C7H18N.CH2O3/c1-2-8-6-4-3-5-7-8;1-5-8(4,6-2)7-3;2-1(3)4/h2-7H,1H2;5-7H2,1-4H3;(H2,2,3,4)/q;+1;.
What are the key properties of carbonic acid;styrene;triethyl(methyl)azanium?
carbonic acid;styrene;triethyl(methyl)azanium has a molecular weight of 282.40 g/mol, XLogP of 4.04, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;styrene;triethyl(methyl)azanium is sourced from PubChem (CID 174590917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).