About styrene;2-sulfonylacetic acid
styrene;2-sulfonylacetic acid (PubChem CID 159570353) has the molecular formula C10H10O4S
and a molecular weight of 226.25 g/mol. Its IUPAC name is styrene;2-sulfonylacetic acid.
Molecular Properties
| Compound Name | styrene;2-sulfonylacetic acid |
| PubChem CID | 159570353 |
| Molecular Formula | C10H10O4S |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | styrene;2-sulfonylacetic acid |
| SMILES | C=Cc1ccccc1.O=C(O)C=S(=O)=O |
| InChI | InChI=1S/C8H8.C2H2O4S/c1-2-8-6-4-3-5-7-8;3-2(4)1-7(5)6/h2-7H,1H2;1H,(H,3,4) |
| InChIKey | MHSQQKDKUQJCCP-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze styrene;2-sulfonylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of styrene;2-sulfonylacetic acid?
The IUPAC name of styrene;2-sulfonylacetic acid (CID 159570353) is styrene;2-sulfonylacetic acid.
What is the SMILES notation for styrene;2-sulfonylacetic acid?
The canonical SMILES for styrene;2-sulfonylacetic acid is C=Cc1ccccc1.O=C(O)C=S(=O)=O.
What is the InChIKey of styrene;2-sulfonylacetic acid?
The InChIKey is MHSQQKDKUQJCCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8.C2H2O4S/c1-2-8-6-4-3-5-7-8;3-2(4)1-7(5)6/h2-7H,1H2;1H,(H,3,4).
What are the key properties of styrene;2-sulfonylacetic acid?
styrene;2-sulfonylacetic acid has a molecular weight of 226.25 g/mol, XLogP of 1.08, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for styrene;2-sulfonylacetic acid is sourced from PubChem (CID 159570353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).