C13H22O6 — CID 173047052
6-hydroxy-2-methylidenehexanoic acid;5-hydroxy-2-methylpent-2-enoic acid (PubChem CID 173047052) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is 6-hydroxy-2-methylidenehexanoic acid;5-hydroxy-2-methylpent-2-enoic acid.
| Compound Name | 6-hydroxy-2-methylidenehexanoic acid;5-hydroxy-2-methylpent-2-enoic acid |
|---|---|
| PubChem CID | 173047052 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 6-hydroxy-2-methylidenehexanoic acid;5-hydroxy-2-methylpent-2-enoic acid |
| SMILES | C=C(CCCCO)C(=O)O.CC(=CCCO)C(=O)O |
| InChI | InChI=1S/C7H12O3.C6H10O3/c1-6(7(9)10)4-2-3-5-8;1-5(6(8)9)3-2-4-7/h8H,1-5H2,(H,9,10);3,7H,2,4H2,1H3,(H,8,9) |
| InChIKey | VQMHSYYSYDQGJR-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|