C11H18O5 — CID 173207382
5-hydroxy-2-methylpent-2-enoic acid;2-methylidenebutanoic acid (PubChem CID 173207382) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is 5-hydroxy-2-methylpent-2-enoic acid;2-methylidenebutanoic acid.
| Compound Name | 5-hydroxy-2-methylpent-2-enoic acid;2-methylidenebutanoic acid |
|---|---|
| PubChem CID | 173207382 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 5-hydroxy-2-methylpent-2-enoic acid;2-methylidenebutanoic acid |
| SMILES | C=C(CC)C(=O)O.CC(=CCCO)C(=O)O |
| InChI | InChI=1S/C6H10O3.C5H8O2/c1-5(6(8)9)3-2-4-7;1-3-4(2)5(6)7/h3,7H,2,4H2,1H3,(H,8,9);2-3H2,1H3,(H,6,7) |
| InChIKey | JEXOYCQVTMUFCI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|