About (2H)chlorane;2-methylidenebutanoic acid
(2H)chlorane;2-methylidenebutanoic acid (PubChem CID 159149807) has the molecular formula C5H9ClO2
and a molecular weight of 137.58 g/mol. Its IUPAC name is (2H)chlorane;2-methylidenebutanoic acid.
Molecular Properties
| Compound Name | (2H)chlorane;2-methylidenebutanoic acid |
| PubChem CID | 159149807 |
| Molecular Formula | C5H9ClO2 |
| Molecular Weight | 137.58 g/mol |
| Exact Mass | 137.04 |
| IUPAC Name | (2H)chlorane;2-methylidenebutanoic acid |
| SMILES | C=C(CC)C(=O)O.[2H]Cl |
| InChI | InChI=1S/C5H8O2.ClH/c1-3-4(2)5(6)7;/h2-3H2,1H3,(H,6,7);1H/i/hD |
| InChIKey | KJDCJDRDJJJFSZ-DYCDLGHISA-N |
| XLogP | 1.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.58 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2H)chlorane;2-methylidenebutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2H)chlorane;2-methylidenebutanoic acid?
The IUPAC name of (2H)chlorane;2-methylidenebutanoic acid (CID 159149807) is (2H)chlorane;2-methylidenebutanoic acid.
What is the SMILES notation for (2H)chlorane;2-methylidenebutanoic acid?
The canonical SMILES for (2H)chlorane;2-methylidenebutanoic acid is C=C(CC)C(=O)O.[2H]Cl.
What is the InChIKey of (2H)chlorane;2-methylidenebutanoic acid?
The InChIKey is KJDCJDRDJJJFSZ-DYCDLGHISA-N. The full InChI is InChI=1S/C5H8O2.ClH/c1-3-4(2)5(6)7;/h2-3H2,1H3,(H,6,7);1H/i/hD.
What are the key properties of (2H)chlorane;2-methylidenebutanoic acid?
(2H)chlorane;2-methylidenebutanoic acid has a molecular weight of 137.58 g/mol, XLogP of 1.46, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2H)chlorane;2-methylidenebutanoic acid is sourced from PubChem (CID 159149807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).