About 2-methylidenebutanoic acid;phenol;hydrate
2-methylidenebutanoic acid;phenol;hydrate (PubChem CID 158804771) has the molecular formula C11H16O4
and a molecular weight of 212.25 g/mol. Its IUPAC name is 2-methylidenebutanoic acid;phenol;hydrate.
Molecular Properties
| Compound Name | 2-methylidenebutanoic acid;phenol;hydrate |
| PubChem CID | 158804771 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 2-methylidenebutanoic acid;phenol;hydrate |
| SMILES | C=C(CC)C(=O)O.O.Oc1ccccc1 |
| InChI | InChI=1S/C6H6O.C5H8O2.H2O/c7-6-4-2-1-3-5-6;1-3-4(2)5(6)7;/h1-5,7H;2-3H2,1H3,(H,6,7);1H2 |
| InChIKey | DRYUDQHUZPIQJP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylidenebutanoic acid;phenol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidenebutanoic acid;phenol;hydrate?
The IUPAC name of 2-methylidenebutanoic acid;phenol;hydrate (CID 158804771) is 2-methylidenebutanoic acid;phenol;hydrate.
What is the SMILES notation for 2-methylidenebutanoic acid;phenol;hydrate?
The canonical SMILES for 2-methylidenebutanoic acid;phenol;hydrate is C=C(CC)C(=O)O.O.Oc1ccccc1.
What is the InChIKey of 2-methylidenebutanoic acid;phenol;hydrate?
The InChIKey is DRYUDQHUZPIQJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O.C5H8O2.H2O/c7-6-4-2-1-3-5-6;1-3-4(2)5(6)7;/h1-5,7H;2-3H2,1H3,(H,6,7);1H2.
What are the key properties of 2-methylidenebutanoic acid;phenol;hydrate?
2-methylidenebutanoic acid;phenol;hydrate has a molecular weight of 212.25 g/mol, XLogP of 1.60, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidenebutanoic acid;phenol;hydrate is sourced from PubChem (CID 158804771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).