C17H24O2 — CID 122506202
3,3-dimethylbut-1-enylbenzene;2-methylidenebutanoic acid (PubChem CID 122506202) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 3,3-dimethylbut-1-enylbenzene;2-methylidenebutanoic acid.
| Compound Name | 3,3-dimethylbut-1-enylbenzene;2-methylidenebutanoic acid |
|---|---|
| PubChem CID | 122506202 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 3,3-dimethylbut-1-enylbenzene;2-methylidenebutanoic acid |
| SMILES | C=C(CC)C(=O)O.CC(C)(C)C=Cc1ccccc1 |
| InChI | InChI=1S/C12H16.C5H8O2/c1-12(2,3)10-9-11-7-5-4-6-8-11;1-3-4(2)5(6)7/h4-10H,1-3H3;2-3H2,1H3,(H,6,7) |
| InChIKey | IIFSRCOBYLASTK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|