3,3-dimethylbut-1-enylbenzene;2-methylidenebutanoic acid

C17H24O2 — CID 122506202

IUPAC3,3-dimethylbut-1-enylbenzene;2-methylidenebutanoic acid
SMILESC=C(CC)C(=O)O.CC(C)(C)C=Cc1ccccc1
InChIInChI=1S/C12H16.C5H8O2/c1-12(2,3)10-9-11-7-5-4-6-8-11;1-3-4(2)5(6)7/h4-10H,1-3H3;2-3H2,1H3,(H,6,7)
InChIKeyIIFSRCOBYLASTK-UHFFFAOYSA-N
MW260.38 g/mol
LogP4.78
Rot. Bonds3

About 3,3-dimethylbut-1-enylbenzene;2-methylidenebutanoic acid

3,3-dimethylbut-1-enylbenzene;2-methylidenebutanoic acid (PubChem CID 122506202) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 3,3-dimethylbut-1-enylbenzene;2-methylidenebutanoic acid.

Molecular Properties

Compound Name3,3-dimethylbut-1-enylbenzene;2-methylidenebutanoic acid
PubChem CID122506202
Molecular FormulaC17H24O2
Molecular Weight260.38 g/mol
Exact Mass260.18
IUPAC Name3,3-dimethylbut-1-enylbenzene;2-methylidenebutanoic acid
SMILESC=C(CC)C(=O)O.CC(C)(C)C=Cc1ccccc1
InChIInChI=1S/C12H16.C5H8O2/c1-12(2,3)10-9-11-7-5-4-6-8-11;1-3-4(2)5(6)7/h4-10H,1-3H3;2-3H2,1H3,(H,6,7)
InChIKeyIIFSRCOBYLASTK-UHFFFAOYSA-N
XLogP4.78
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.38
LogP ≤ 54.78
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3,3-dimethylbut-1-enylbenzene;2-methylidenebutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,3-dimethylbut-1-enylbenzene;2-methylidenebutanoic acid?
The IUPAC name of 3,3-dimethylbut-1-enylbenzene;2-methylidenebutanoic acid (CID 122506202) is 3,3-dimethylbut-1-enylbenzene;2-methylidenebutanoic acid.
What is the SMILES notation for 3,3-dimethylbut-1-enylbenzene;2-methylidenebutanoic acid?
The canonical SMILES for 3,3-dimethylbut-1-enylbenzene;2-methylidenebutanoic acid is C=C(CC)C(=O)O.CC(C)(C)C=Cc1ccccc1.
What is the InChIKey of 3,3-dimethylbut-1-enylbenzene;2-methylidenebutanoic acid?
The InChIKey is IIFSRCOBYLASTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16.C5H8O2/c1-12(2,3)10-9-11-7-5-4-6-8-11;1-3-4(2)5(6)7/h4-10H,1-3H3;2-3H2,1H3,(H,6,7).
What are the key properties of 3,3-dimethylbut-1-enylbenzene;2-methylidenebutanoic acid?
3,3-dimethylbut-1-enylbenzene;2-methylidenebutanoic acid has a molecular weight of 260.38 g/mol, XLogP of 4.78, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethylbut-1-enylbenzene;2-methylidenebutanoic acid is sourced from PubChem (CID 122506202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).