C19H24O4 — CID 69286531
2-methylidenehexanoic acid;2-methylidene-5-phenylpent-4-enoic acid (PubChem CID 69286531) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is 2-methylidenehexanoic acid;2-methylidene-5-phenylpent-4-enoic acid.
| Compound Name | 2-methylidenehexanoic acid;2-methylidene-5-phenylpent-4-enoic acid |
|---|---|
| PubChem CID | 69286531 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 2-methylidenehexanoic acid;2-methylidene-5-phenylpent-4-enoic acid |
| SMILES | C=C(CC=Cc1ccccc1)C(=O)O.C=C(CCCC)C(=O)O |
| InChI | InChI=1S/C12H12O2.C7H12O2/c1-10(12(13)14)6-5-9-11-7-3-2-4-8-11;1-3-4-5-6(2)7(8)9/h2-5,7-9H,1,6H2,(H,13,14);2-5H2,1H3,(H,8,9) |
| InChIKey | NIZMPECPMRNVAO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|