C24H34O4 — CID 67332717
2-ethylhexyl 2-methylprop-2-enoate;2-methylidene-5-phenylpent-4-enoic acid (PubChem CID 67332717) has the molecular formula C24H34O4 and a molecular weight of 386.53 g/mol. Its IUPAC name is 2-ethylhexyl 2-methylprop-2-enoate;2-methylidene-5-phenylpent-4-enoic acid.
| Compound Name | 2-ethylhexyl 2-methylprop-2-enoate;2-methylidene-5-phenylpent-4-enoic acid |
|---|---|
| PubChem CID | 67332717 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | 2-ethylhexyl 2-methylprop-2-enoate;2-methylidene-5-phenylpent-4-enoic acid |
| SMILES | C=C(C)C(=O)OCC(CC)CCCC.C=C(CC=Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C12H12O2.C12H22O2/c1-10(12(13)14)6-5-9-11-7-3-2-4-8-11;1-5-7-8-11(6-2)9-14-12(13)10(3)4/h2-5,7-9H,1,6H2,(H,13,14);11H,3,5-9H2,1-2,4H3 |
| InChIKey | JZZIPUDQYQOVPN-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|